C16H11FO5S — CID 7246257
3-(2-fluorophenyl)sulfonyl-6-methoxychromen-2-one (PubChem CID 7246257) has the molecular formula C16H11FO5S and a molecular weight of 334.32 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfonyl-6-methoxychromen-2-one.
| Compound Name | 3-(2-fluorophenyl)sulfonyl-6-methoxychromen-2-one |
|---|---|
| PubChem CID | 7246257 |
| Molecular Formula | C16H11FO5S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-(2-fluorophenyl)sulfonyl-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)c(S(=O)(=O)c3ccccc3F)cc2c1 |
| InChI | InChI=1S/C16H11FO5S/c1-21-11-6-7-13-10(8-11)9-15(16(18)22-13)23(19,20)14-5-3-2-4-12(14)17/h2-9H,1H3 |
| InChIKey | FMFNMWOKGGMBCA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|