C18H16O5S — CID 2134720
3-(3,4-dimethylphenyl)sulfonyl-6-methoxychromen-2-one (PubChem CID 2134720) has the molecular formula C18H16O5S and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)sulfonyl-6-methoxychromen-2-one.
| Compound Name | 3-(3,4-dimethylphenyl)sulfonyl-6-methoxychromen-2-one |
|---|---|
| PubChem CID | 2134720 |
| Molecular Formula | C18H16O5S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 3-(3,4-dimethylphenyl)sulfonyl-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)c(S(=O)(=O)c3ccc(C)c(C)c3)cc2c1 |
| InChI | InChI=1S/C18H16O5S/c1-11-4-6-15(8-12(11)2)24(20,21)17-10-13-9-14(22-3)5-7-16(13)23-18(17)19/h4-10H,1-3H3 |
| InChIKey | VRZZAMCJWMONTA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|