C10H9NO5S — CID 164608873
6-methoxy-2-oxochromene-3-sulfonamide (PubChem CID 164608873) has the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. Its IUPAC name is 6-methoxy-2-oxochromene-3-sulfonamide.
| Compound Name | 6-methoxy-2-oxochromene-3-sulfonamide |
|---|---|
| PubChem CID | 164608873 |
| Molecular Formula | C10H9NO5S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 6-methoxy-2-oxochromene-3-sulfonamide |
| SMILES | COc1ccc2oc(=O)c(S(N)(=O)=O)cc2c1 |
| InChI | InChI=1S/C10H9NO5S/c1-15-7-2-3-8-6(4-7)5-9(10(12)16-8)17(11,13)14/h2-5H,1H3,(H2,11,13,14) |
| InChIKey | BKWNFAYLEISDTB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|