C22H25F3O3S2 — CID 164597266
S-[8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl] prop-2-enethioate (PubChem CID 164597266) has the molecular formula C22H25F3O3S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is S-[8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl] prop-2-enethioate.
| Compound Name | S-[8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl] prop-2-enethioate |
|---|---|
| PubChem CID | 164597266 |
| Molecular Formula | C22H25F3O3S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | S-[8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCCCCCCCCOc1cccc2sc(=O)c(C(F)(F)F)c(C)c12 |
| InChI | InChI=1S/C22H25F3O3S2/c1-3-18(26)29-14-9-7-5-4-6-8-13-28-16-11-10-12-17-19(16)15(2)20(21(27)30-17)22(23,24)25/h3,10-12H,1,4-9,13-14H2,2H3 |
| InChIKey | NYOGWXJCHARYRX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|