C18H19FO4S2 — CID 164597294
S-[2-[2-(3-fluoro-4,6-dimethyl-2-oxothiochromen-7-yl)oxyethoxy]ethyl] prop-2-enethioate (PubChem CID 164597294) has the molecular formula C18H19FO4S2 and a molecular weight of 382.48 g/mol. Its IUPAC name is S-[2-[2-(3-fluoro-4,6-dimethyl-2-oxothiochromen-7-yl)oxyethoxy]ethyl] prop-2-enethioate.
| Compound Name | S-[2-[2-(3-fluoro-4,6-dimethyl-2-oxothiochromen-7-yl)oxyethoxy]ethyl] prop-2-enethioate |
|---|---|
| PubChem CID | 164597294 |
| Molecular Formula | C18H19FO4S2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | S-[2-[2-(3-fluoro-4,6-dimethyl-2-oxothiochromen-7-yl)oxyethoxy]ethyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCCOCCOc1cc2sc(=O)c(F)c(C)c2cc1C |
| InChI | InChI=1S/C18H19FO4S2/c1-4-16(20)24-8-7-22-5-6-23-14-10-15-13(9-11(14)2)12(3)17(19)18(21)25-15/h4,9-10H,1,5-8H2,2-3H3 |
| InChIKey | SLXMTJCJPXZADB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|