C21H24N4O3S2 — CID 164599622
N-(1,3-benzothiazol-2-yl)-4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 164599622) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 164599622 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CCS(=O)(=O)N1CCN(Cc2ccc(C(=O)Nc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C21H24N4O3S2/c1-2-30(27,28)25-13-11-24(12-14-25)15-16-7-9-17(10-8-16)20(26)23-21-22-18-5-3-4-6-19(18)29-21/h3-10H,2,11-15H2,1H3,(H,22,23,26) |
| InChIKey | RXUHZXWEMHRFOQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |