C24H32N4O4S — CID 38097121
2-[[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]-N-propylbenzamide (PubChem CID 38097121) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 2-[[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]-N-propylbenzamide.
| Compound Name | 2-[[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 38097121 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-[[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccccc1NC(=O)c1ccc(CN2CCN(S(=O)(=O)CC)CC2)cc1 |
| InChI | InChI=1S/C24H32N4O4S/c1-3-13-25-24(30)21-7-5-6-8-22(21)26-23(29)20-11-9-19(10-12-20)18-27-14-16-28(17-15-27)33(31,32)4-2/h5-12H,3-4,13-18H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | WKZIJWMJZFLMAT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |