C25H32N4O4S — CID 38099687
4-[(4-methylsulfonylpiperazin-1-yl)methyl]-N-[2-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 38099687) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 4-[(4-methylsulfonylpiperazin-1-yl)methyl]-N-[2-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 4-[(4-methylsulfonylpiperazin-1-yl)methyl]-N-[2-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 38099687 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 4-[(4-methylsulfonylpiperazin-1-yl)methyl]-N-[2-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2ccc(C(=O)Nc3ccccc3C(=O)N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C25H32N4O4S/c1-34(32,33)29-17-15-27(16-18-29)19-20-9-11-21(12-10-20)24(30)26-23-8-4-3-7-22(23)25(31)28-13-5-2-6-14-28/h3-4,7-12H,2,5-6,13-19H2,1H3,(H,26,30) |
| InChIKey | DRJASVIZSNGXEE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |