C29H34N4O4S — CID 43923542
2-[[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 43923542) has the molecular formula C29H34N4O4S and a molecular weight of 534.68 g/mol. Its IUPAC name is 2-[[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 43923542 |
| Molecular Formula | C29H34N4O4S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 2-[[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzoyl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | CCS(=O)(=O)N1CCN(Cc2ccc(C(=O)Nc3ccccc3C(=O)NCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H34N4O4S/c1-2-38(36,37)33-20-18-32(19-21-33)22-24-12-14-25(15-13-24)28(34)31-27-11-7-6-10-26(27)29(35)30-17-16-23-8-4-3-5-9-23/h3-15H,2,16-22H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | WNXCRPNAICXZLX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |