C28H31N3O4S — CID 46763665
N-(2-phenylethyl)-2-[[4-(piperidin-1-ylsulfonylmethyl)benzoyl]amino]benzamide (PubChem CID 46763665) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-[[4-(piperidin-1-ylsulfonylmethyl)benzoyl]amino]benzamide.
| Compound Name | N-(2-phenylethyl)-2-[[4-(piperidin-1-ylsulfonylmethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 46763665 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-(2-phenylethyl)-2-[[4-(piperidin-1-ylsulfonylmethyl)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCCc1ccccc1)c1ccc(CS(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H31N3O4S/c32-27(24-15-13-23(14-16-24)21-36(34,35)31-19-7-2-8-20-31)30-26-12-6-5-11-25(26)28(33)29-18-17-22-9-3-1-4-10-22/h1,3-6,9-16H,2,7-8,17-21H2,(H,29,33)(H,30,32) |
| InChIKey | FEFMSKGCZHVMJI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |