C23H25FN6O2 — CID 164600127
N-(5-cyano-6-cyclopropyloxy-3-pyridinyl)-11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;ethane (PubChem CID 164600127) has the molecular formula C23H25FN6O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is N-(5-cyano-6-cyclopropyloxy-3-pyridinyl)-11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;ethane.
| Compound Name | N-(5-cyano-6-cyclopropyloxy-3-pyridinyl)-11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;ethane |
|---|---|
| PubChem CID | 164600127 |
| Molecular Formula | C23H25FN6O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-(5-cyano-6-cyclopropyloxy-3-pyridinyl)-11-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;ethane |
| SMILES | CC.CC1(C)CC(C(=O)Nc2cnc(OC3CC3)c(C#N)c2)c2cnc3cc(F)nn3c21 |
| InChI | InChI=1S/C21H19FN6O2.C2H6/c1-21(2)7-14(15-10-24-17-6-16(22)27-28(17)18(15)21)19(29)26-12-5-11(8-23)20(25-9-12)30-13-3-4-13;1-2/h5-6,9-10,13-14H,3-4,7H2,1-2H3,(H,26,29);1-2H3 |
| InChIKey | WGBCVKDIVYKOMA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |