C25H33N9O — CID 164600264
N-[5-cyano-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-3,3,11-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;ethane (PubChem CID 164600264) has the molecular formula C25H33N9O and a molecular weight of 475.60 g/mol. Its IUPAC name is N-[5-cyano-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-3,3,11-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;ethane.
| Compound Name | N-[5-cyano-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-3,3,11-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;ethane |
|---|---|
| PubChem CID | 164600264 |
| Molecular Formula | C25H33N9O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | N-[5-cyano-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-3,3,11-trimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;ethane |
| SMILES | CC.CC.[H]/N=C/C=N\Nc1ncc(NC(=O)C2CC(C)(C)c3c2cnc2cc(C)nn32)cc1C#N |
| InChI | InChI=1S/C21H21N9O.2C2H6/c1-12-6-17-24-11-16-15(8-21(2,3)18(16)30(17)29-12)20(31)27-14-7-13(9-23)19(25-10-14)28-26-5-4-22;2*1-2/h4-7,10-11,15,22H,8H2,1-3H3,(H,25,28)(H,27,31);2*1-2H3/b22-4+,26-5-;; |
| InChIKey | DERFCAMGRFHCTJ-GMTNLLQPSA-N |
| XLogP | 4.81 |
| TPSA | 144.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|