C19H18ClFN8O — CID 164600220
N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-10-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 164600220) has the molecular formula C19H18ClFN8O and a molecular weight of 428.86 g/mol. Its IUPAC name is N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-10-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-10-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 164600220 |
| Molecular Formula | C19H18ClFN8O |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-10-fluoro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | [H]/N=C/C=N\Nc1ncc(NC(=O)C2CC(C)(C)c3c2cnc2c(F)cnn32)cc1Cl |
| InChI | InChI=1S/C19H18ClFN8O/c1-19(2)6-11(12-8-24-17-14(21)9-26-29(17)15(12)19)18(30)27-10-5-13(20)16(23-7-10)28-25-4-3-22/h3-5,7-9,11,22H,6H2,1-2H3,(H,23,28)(H,27,30)/b22-3+,25-4- |
| InChIKey | XYXWOYOTVFIKHD-JPBXQWNDSA-N |
| XLogP | 3.37 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|