C21H20Cl2N8O3 — CID 164600006
methyl (2E)-2-[[3-chloro-5-[(11-chloro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbonyl)amino]-2-pyridinyl]hydrazinylidene]-3-iminopropanoate (PubChem CID 164600006) has the molecular formula C21H20Cl2N8O3 and a molecular weight of 503.35 g/mol. Its IUPAC name is methyl (2E)-2-[[3-chloro-5-[(11-chloro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbonyl)amino]-2-pyridinyl]hydrazinylidene]-3-iminopropanoate.
| Compound Name | methyl (2E)-2-[[3-chloro-5-[(11-chloro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbonyl)amino]-2-pyridinyl]hydrazinylidene]-3-iminopropanoate |
|---|---|
| PubChem CID | 164600006 |
| Molecular Formula | C21H20Cl2N8O3 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | methyl (2E)-2-[[3-chloro-5-[(11-chloro-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carbonyl)amino]-2-pyridinyl]hydrazinylidene]-3-iminopropanoate |
| SMILES | [H]/N=C/C(=N\Nc1ncc(NC(=O)C2CC(C)(C)c3c2cnc2cc(Cl)nn32)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C21H20Cl2N8O3/c1-21(2)6-11(12-9-25-16-5-15(23)30-31(16)17(12)21)19(32)27-10-4-13(22)18(26-8-10)29-28-14(7-24)20(33)34-3/h4-5,7-9,11,24H,6H2,1-3H3,(H,26,29)(H,27,32)/b24-7+,28-14+ |
| InChIKey | VNYZNDDYGKGXMM-ABQHGMKUSA-N |
| XLogP | 3.43 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|