C22H24Cl2N8O2 — CID 171466348
11-chloro-N-[5-chloro-6-[(2E)-2-(3-hydroxy-1-imino-3-methylbutan-2-ylidene)hydrazinyl]-3-pyridinyl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 171466348) has the molecular formula C22H24Cl2N8O2 and a molecular weight of 503.39 g/mol. Its IUPAC name is 11-chloro-N-[5-chloro-6-[(2E)-2-(3-hydroxy-1-imino-3-methylbutan-2-ylidene)hydrazinyl]-3-pyridinyl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | 11-chloro-N-[5-chloro-6-[(2E)-2-(3-hydroxy-1-imino-3-methylbutan-2-ylidene)hydrazinyl]-3-pyridinyl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 171466348 |
| Molecular Formula | C22H24Cl2N8O2 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 11-chloro-N-[5-chloro-6-[(2E)-2-(3-hydroxy-1-imino-3-methylbutan-2-ylidene)hydrazinyl]-3-pyridinyl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | [H]/N=C/C(=N\Nc1ncc(NC(=O)C2CC(C)(C)c3c2cnc2cc(Cl)nn32)cc1Cl)C(C)(C)O |
| InChI | InChI=1S/C22H24Cl2N8O2/c1-21(2)7-12(13-10-26-17-6-16(24)31-32(17)18(13)21)20(33)28-11-5-14(23)19(27-9-11)30-29-15(8-25)22(3,4)34/h5-6,8-10,12,25,34H,7H2,1-4H3,(H,27,30)(H,28,33)/b25-8+,29-15+ |
| InChIKey | IKKTUHMAAFSJPR-MPTIFMLDSA-N |
| XLogP | 4.02 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|