C20H18ClN9O — CID 164600305
N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-11-cyano-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 164600305) has the molecular formula C20H18ClN9O and a molecular weight of 435.88 g/mol. Its IUPAC name is N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-11-cyano-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-11-cyano-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 164600305 |
| Molecular Formula | C20H18ClN9O |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-11-cyano-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | [H]/N=C/C=N\Nc1ncc(NC(=O)C2CC(C)(C)c3c2cnc2cc(C#N)nn32)cc1Cl |
| InChI | InChI=1S/C20H18ClN9O/c1-20(2)7-13(14-10-24-16-6-11(8-23)29-30(16)17(14)20)19(31)27-12-5-15(21)18(25-9-12)28-26-4-3-22/h3-6,9-10,13,22H,7H2,1-2H3,(H,25,28)(H,27,31)/b22-3+,26-4- |
| InChIKey | OCGFXSFOYJFTEH-FADJPCANSA-N |
| XLogP | 3.10 |
| TPSA | 144.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|