C27H36BN4O5 — CID 164601686
CID 164601686 (PubChem CID 164601686) has the molecular formula C27H36BN4O5 and a molecular weight of 507.42 g/mol.
| Compound Name | CID 164601686 |
|---|---|
| PubChem CID | 164601686 |
| Molecular Formula | C27H36BN4O5 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | — |
| SMILES | CC.CCc1ccc(C(=O)N2CCN(Cc3nc4ccc(C(=O)O)cc4n3CC3CCO3)CC2)o1.[B]=C |
| InChI | InChI=1S/C24H28N4O5.C2H6.CH2B/c1-2-17-4-6-21(33-17)23(29)27-10-8-26(9-11-27)15-22-25-19-5-3-16(24(30)31)13-20(19)28(22)14-18-7-12-32-18;2*1-2/h3-6,13,18H,2,7-12,14-15H2,1H3,(H,30,31);1-2H3;1H2 |
| InChIKey | IOCHHYYUWFMEAA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|