C11H16O2 — CID 164603581
5,6-bis(ethenyl)-2,3-dihydropyran-4-one;ethane (PubChem CID 164603581) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-2,3-dihydropyran-4-one;ethane.
| Compound Name | 5,6-bis(ethenyl)-2,3-dihydropyran-4-one;ethane |
|---|---|
| PubChem CID | 164603581 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 5,6-bis(ethenyl)-2,3-dihydropyran-4-one;ethane |
| SMILES | C=CC1=C(C=C)C(=O)CCO1.CC |
| InChI | InChI=1S/C9H10O2.C2H6/c1-3-7-8(10)5-6-11-9(7)4-2;1-2/h3-4H,1-2,5-6H2;1-2H3 |
| InChIKey | ZYSZWSLEIJAMFO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |