C11H15FO2 — CID 91324959
6-butyl-5-[(E)-2-fluoroethenyl]-2,3-dihydropyran-4-one (PubChem CID 91324959) has the molecular formula C11H15FO2 and a molecular weight of 198.24 g/mol. Its IUPAC name is 6-butyl-5-[(E)-2-fluoroethenyl]-2,3-dihydropyran-4-one.
| Compound Name | 6-butyl-5-[(E)-2-fluoroethenyl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 91324959 |
| Molecular Formula | C11H15FO2 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 6-butyl-5-[(E)-2-fluoroethenyl]-2,3-dihydropyran-4-one |
| SMILES | CCCCC1=C(/C=C/F)C(=O)CCO1 |
| InChI | InChI=1S/C11H15FO2/c1-2-3-4-11-9(5-7-12)10(13)6-8-14-11/h5,7H,2-4,6,8H2,1H3/b7-5+ |
| InChIKey | OIGFIKBCCAHQTO-FNORWQNLSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |