C10H12O2 — CID 142586691
5,6-bis(ethenyl)-2-methyl-2,3-dihydropyran-4-one (PubChem CID 142586691) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-2-methyl-2,3-dihydropyran-4-one.
| Compound Name | 5,6-bis(ethenyl)-2-methyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 142586691 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 5,6-bis(ethenyl)-2-methyl-2,3-dihydropyran-4-one |
| SMILES | C=CC1=C(C=C)C(=O)CC(C)O1 |
| InChI | InChI=1S/C10H12O2/c1-4-8-9(11)6-7(3)12-10(8)5-2/h4-5,7H,1-2,6H2,3H3 |
| InChIKey | RTELSWBKEGJXAF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |