C19H9Cl2F3N2O4 — CID 164603763
3-[1-(3,5-dichlorophenyl)pyrazol-4-yl]-7,8-dihydroxy-2-(trifluoromethyl)chromen-4-one (PubChem CID 164603763) has the molecular formula C19H9Cl2F3N2O4 and a molecular weight of 457.19 g/mol. Its IUPAC name is 3-[1-(3,5-dichlorophenyl)pyrazol-4-yl]-7,8-dihydroxy-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-[1-(3,5-dichlorophenyl)pyrazol-4-yl]-7,8-dihydroxy-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 164603763 |
| Molecular Formula | C19H9Cl2F3N2O4 |
| Molecular Weight | 457.19 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 3-[1-(3,5-dichlorophenyl)pyrazol-4-yl]-7,8-dihydroxy-2-(trifluoromethyl)chromen-4-one |
| SMILES | O=c1c(-c2cnn(-c3cc(Cl)cc(Cl)c3)c2)c(C(F)(F)F)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C19H9Cl2F3N2O4/c20-9-3-10(21)5-11(4-9)26-7-8(6-25-26)14-15(28)12-1-2-13(27)16(29)17(12)30-18(14)19(22,23)24/h1-7,27,29H |
| InChIKey | JFRRBZVXMNJDJO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.19 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|