C20H37NO3 — CID 164604144
N-[1,3-bis(cyclohexylmethoxy)butan-2-yl]acetamide (PubChem CID 164604144) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is N-[1,3-bis(cyclohexylmethoxy)butan-2-yl]acetamide.
| Compound Name | N-[1,3-bis(cyclohexylmethoxy)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 164604144 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | N-[1,3-bis(cyclohexylmethoxy)butan-2-yl]acetamide |
| SMILES | CC(=O)NC(COCC1CCCCC1)C(C)OCC1CCCCC1 |
| InChI | InChI=1S/C20H37NO3/c1-16(24-14-19-11-7-4-8-12-19)20(21-17(2)22)15-23-13-18-9-5-3-6-10-18/h16,18-20H,3-15H2,1-2H3,(H,21,22) |
| InChIKey | YLSJLEUNDYIONE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |