C18H33N3O3 — CID 170755642
N-[1-[2-(aminomethyl)pyrrolidin-1-yl]-3-(cyclohexylmethoxy)-1-oxobutan-2-yl]acetamide (PubChem CID 170755642) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[1-[2-(aminomethyl)pyrrolidin-1-yl]-3-(cyclohexylmethoxy)-1-oxobutan-2-yl]acetamide.
| Compound Name | N-[1-[2-(aminomethyl)pyrrolidin-1-yl]-3-(cyclohexylmethoxy)-1-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 170755642 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | N-[1-[2-(aminomethyl)pyrrolidin-1-yl]-3-(cyclohexylmethoxy)-1-oxobutan-2-yl]acetamide |
| SMILES | CC(=O)NC(C(=O)N1CCCC1CN)C(C)OCC1CCCCC1 |
| InChI | InChI=1S/C18H33N3O3/c1-13(24-12-15-7-4-3-5-8-15)17(20-14(2)22)18(23)21-10-6-9-16(21)11-19/h13,15-17H,3-12,19H2,1-2H3,(H,20,22) |
| InChIKey | AGIDJJANUUPBKY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |