C15H30N2O4 — CID 164604737
2-acetamido-N-methyl-3-(oxan-4-ylmethoxy)butanamide;ethane (PubChem CID 164604737) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-acetamido-N-methyl-3-(oxan-4-ylmethoxy)butanamide;ethane.
| Compound Name | 2-acetamido-N-methyl-3-(oxan-4-ylmethoxy)butanamide;ethane |
|---|---|
| PubChem CID | 164604737 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-acetamido-N-methyl-3-(oxan-4-ylmethoxy)butanamide;ethane |
| SMILES | CC.CNC(=O)C(NC(C)=O)C(C)OCC1CCOCC1 |
| InChI | InChI=1S/C13H24N2O4.C2H6/c1-9(12(13(17)14-3)15-10(2)16)19-8-11-4-6-18-7-5-11;1-2/h9,11-12H,4-8H2,1-3H3,(H,14,17)(H,15,16);1-2H3 |
| InChIKey | DUEKZGRYTRYCMO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |