C17H15Cl2N5O5 — CID 164606551
2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-6-(hydroxymethylidene)-1,2,4-triazinane-3,5-dione (PubChem CID 164606551) has the molecular formula C17H15Cl2N5O5 and a molecular weight of 440.24 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-6-(hydroxymethylidene)-1,2,4-triazinane-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-6-(hydroxymethylidene)-1,2,4-triazinane-3,5-dione |
|---|---|
| PubChem CID | 164606551 |
| Molecular Formula | C17H15Cl2N5O5 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-6-(hydroxymethylidene)-1,2,4-triazinane-3,5-dione |
| SMILES | CC(C)c1cc(Oc2c(Cl)cc(N3NC(=CO)C(=O)NC3=O)cc2Cl)n[nH]c1=O |
| InChI | InChI=1S/C17H15Cl2N5O5/c1-7(2)9-5-13(21-22-15(9)26)29-14-10(18)3-8(4-11(14)19)24-17(28)20-16(27)12(6-25)23-24/h3-7,23,25H,1-2H3,(H,22,26)(H,20,27,28) |
| InChIKey | ONSQJZKIPZWEMK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|