C31H41F4N5O3 — CID 164607973
N-[5-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide (PubChem CID 164607973) has the molecular formula C31H41F4N5O3 and a molecular weight of 607.69 g/mol. Its IUPAC name is N-[5-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide.
| Compound Name | N-[5-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164607973 |
| Molecular Formula | C31H41F4N5O3 |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | N-[5-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3CCN(C(=O)CC(C)(C)C)CC3)cc2NC(=O)C2C=NC(=O)C=C2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C31H41F4N5O3/c1-18-16-40(17-19(2)38(18)6)26-13-24(32)21(20-7-9-39(10-8-20)28(42)14-30(3,4)5)11-25(26)37-29(43)22-15-36-27(41)12-23(22)31(33,34)35/h11-13,15,18-20,22H,7-10,14,16-17H2,1-6H3,(H,37,43)/t18-,19+,22? |
| InChIKey | FBPMGBPMEGTPSF-QIDMFYOTSA-N |
| XLogP | 5.15 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |