C29H29F4N7O2S — CID 164608197
N-[5-[1-(4-cyano-1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide (PubChem CID 164608197) has the molecular formula C29H29F4N7O2S and a molecular weight of 615.66 g/mol. Its IUPAC name is N-[5-[1-(4-cyano-1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide.
| Compound Name | N-[5-[1-(4-cyano-1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164608197 |
| Molecular Formula | C29H29F4N7O2S |
| Molecular Weight | 615.66 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | N-[5-[1-(4-cyano-1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCCN(c4nc(C#N)cs4)C3)cc2NC(=O)C2C=NC(=O)C=C2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C29H29F4N7O2S/c1-16-12-40(13-17(2)38(16)3)25-9-23(30)20(18-5-4-6-39(14-18)28-36-19(10-34)15-43-28)7-24(25)37-27(42)21-11-35-26(41)8-22(21)29(31,32)33/h5,7-9,11,15-17,21H,4,6,12-14H2,1-3H3,(H,37,42)/t16-,17+,21? |
| InChIKey | FFEQYIVLFYODFU-QRTHJKPMSA-N |
| XLogP | 4.63 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|