C29H32F3N7OS — CID 138551673
N-[5-[1-(5-cyano-1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(difluoromethyl)-1,2-dihydropyridine-5-carboxamide (PubChem CID 138551673) has the molecular formula C29H32F3N7OS and a molecular weight of 583.68 g/mol. Its IUPAC name is N-[5-[1-(5-cyano-1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(difluoromethyl)-1,2-dihydropyridine-5-carboxamide.
| Compound Name | N-[5-[1-(5-cyano-1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(difluoromethyl)-1,2-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 138551673 |
| Molecular Formula | C29H32F3N7OS |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | N-[5-[1-(5-cyano-1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(difluoromethyl)-1,2-dihydropyridine-5-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCCN(c4ncc(C#N)s4)C3)cc2NC(=O)C2=CNCC=C2C(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C29H32F3N7OS/c1-17-14-39(15-18(2)37(17)3)26-10-24(30)22(19-5-4-8-38(16-19)29-35-12-20(11-33)41-29)9-25(26)36-28(40)23-13-34-7-6-21(23)27(31)32/h5-6,9-10,12-13,17-18,27,34H,4,7-8,14-16H2,1-3H3,(H,36,40)/t17-,18+ |
| InChIKey | OZDAWFXKTXRKGM-HDICACEKSA-N |
| XLogP | 4.59 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|