C29H34F3N7O2S — CID 145359871
N-[5-[1-(5-amino-1,3-thiazol-2-yl)-2,3,6,7-tetrahydroazepin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(difluoromethyl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 145359871) has the molecular formula C29H34F3N7O2S and a molecular weight of 601.70 g/mol. Its IUPAC name is N-[5-[1-(5-amino-1,3-thiazol-2-yl)-2,3,6,7-tetrahydroazepin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(difluoromethyl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[5-[1-(5-amino-1,3-thiazol-2-yl)-2,3,6,7-tetrahydroazepin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(difluoromethyl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145359871 |
| Molecular Formula | C29H34F3N7O2S |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | N-[5-[1-(5-amino-1,3-thiazol-2-yl)-2,3,6,7-tetrahydroazepin-4-yl]-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(difluoromethyl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCCN(c4ncc(N)s4)CC3)cc2NC(=O)c2c[nH]c(=O)cc2C(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C29H34F3N7O2S/c1-16-14-39(15-17(2)37(16)3)24-11-22(30)19(18-5-4-7-38(8-6-18)29-35-13-25(33)42-29)9-23(24)36-28(41)21-12-34-26(40)10-20(21)27(31)32/h5,9-13,16-17,27H,4,6-8,14-15,33H2,1-3H3,(H,34,40)(H,36,41)/t16-,17+ |
| InChIKey | QRRPYDPTNPGQCL-CALCHBBNSA-N |
| XLogP | 4.96 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|