C30H34F5N5O4 — CID 137377162
(3,3-difluorocyclobutyl) 4-[5-[[4-(difluoromethyl)-6-oxo-1H-pyridine-3-carbonyl]amino]-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 137377162) has the molecular formula C30H34F5N5O4 and a molecular weight of 623.62 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl) 4-[5-[[4-(difluoromethyl)-6-oxo-1H-pyridine-3-carbonyl]amino]-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | (3,3-difluorocyclobutyl) 4-[5-[[4-(difluoromethyl)-6-oxo-1H-pyridine-3-carbonyl]amino]-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 137377162 |
| Molecular Formula | C30H34F5N5O4 |
| Molecular Weight | 623.62 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | (3,3-difluorocyclobutyl) 4-[5-[[4-(difluoromethyl)-6-oxo-1H-pyridine-3-carbonyl]amino]-2-fluoro-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCN(C(=O)OC4CC(F)(F)C4)CC3)cc2NC(=O)c2c[nH]c(=O)cc2C(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C30H34F5N5O4/c1-16-14-40(15-17(2)38(16)3)25-10-23(31)20(8-24(25)37-28(42)22-13-36-26(41)9-21(22)27(32)33)18-4-6-39(7-5-18)29(43)44-19-11-30(34,35)12-19/h4,8-10,13,16-17,19,27H,5-7,11-12,14-15H2,1-3H3,(H,36,41)(H,37,42)/t16-,17+ |
| InChIKey | LDLPWKDYKVBJTG-CALCHBBNSA-N |
| XLogP | 5.26 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|