C30H32F7N5O4 — CID 138458719
(3,3-difluorocyclobutyl) 5-[2,6-difluoro-3-[[6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 138458719) has the molecular formula C30H32F7N5O4 and a molecular weight of 659.60 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl) 5-[2,6-difluoro-3-[[6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | (3,3-difluorocyclobutyl) 5-[2,6-difluoro-3-[[6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 138458719 |
| Molecular Formula | C30H32F7N5O4 |
| Molecular Weight | 659.60 g/mol |
| Exact Mass | 659.23 |
| IUPAC Name | (3,3-difluorocyclobutyl) 5-[2,6-difluoro-3-[[6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1CN(c2cc(F)c(C3=CCCN(C(=O)OC4CC(F)(F)C4)C3)c(F)c2NC(=O)c2c[nH]c(=O)cc2C(F)(F)F)CC(C)N1C |
| InChI | InChI=1S/C30H32F7N5O4/c1-15-12-42(13-16(2)40(15)3)22-8-21(31)24(17-5-4-6-41(14-17)28(45)46-18-9-29(33,34)10-18)25(32)26(22)39-27(44)19-11-38-23(43)7-20(19)30(35,36)37/h5,7-8,11,15-16,18H,4,6,9-10,12-14H2,1-3H3,(H,38,43)(H,39,44) |
| InChIKey | DPTKZRVQZOKIBW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|