C29H35F4N5O4 — CID 164608173
propan-2-yl 5-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 164608173) has the molecular formula C29H35F4N5O4 and a molecular weight of 593.62 g/mol. Its IUPAC name is propan-2-yl 5-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | propan-2-yl 5-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 164608173 |
| Molecular Formula | C29H35F4N5O4 |
| Molecular Weight | 593.62 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | propan-2-yl 5-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC=C(c2cc(NC(=O)C3C=NC(=O)C=C3C(F)(F)F)c(N3C[C@@H](C)N(C)[C@@H](C)C3)cc2F)C1 |
| InChI | InChI=1S/C29H35F4N5O4/c1-16(2)42-28(41)37-8-6-7-19(15-37)20-9-24(25(11-23(20)30)38-13-17(3)36(5)18(4)14-38)35-27(40)21-12-34-26(39)10-22(21)29(31,32)33/h7,9-12,16-18,21H,6,8,13-15H2,1-5H3,(H,35,40)/t17-,18+,21? |
| InChIKey | FVJJQTCVKGSYKC-HTZLVSCSSA-N |
| XLogP | 4.64 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|