C18H18Cl2N6O — CID 164608769
1-(2,6-dichloro-4-pyridinyl)-3-[[5-(1,3-dimethylpyrazol-4-yl)-4-methyl-2-pyridinyl]methyl]urea (PubChem CID 164608769) has the molecular formula C18H18Cl2N6O and a molecular weight of 405.29 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[[5-(1,3-dimethylpyrazol-4-yl)-4-methyl-2-pyridinyl]methyl]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[5-(1,3-dimethylpyrazol-4-yl)-4-methyl-2-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 164608769 |
| Molecular Formula | C18H18Cl2N6O |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[5-(1,3-dimethylpyrazol-4-yl)-4-methyl-2-pyridinyl]methyl]urea |
| SMILES | Cc1cc(CNC(=O)Nc2cc(Cl)nc(Cl)c2)ncc1-c1cn(C)nc1C |
| InChI | InChI=1S/C18H18Cl2N6O/c1-10-4-13(21-8-14(10)15-9-26(3)25-11(15)2)7-22-18(27)23-12-5-16(19)24-17(20)6-12/h4-6,8-9H,7H2,1-3H3,(H2,22,23,24,27) |
| InChIKey | UVMBQPYBPGOJBF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|