C19H20N2O2 — CID 164610079
(3S,5'S,6'S,8'R,11'S)-2'-ethenylspiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2-one (PubChem CID 164610079) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (3S,5'S,6'S,8'R,11'S)-2'-ethenylspiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2-one.
| Compound Name | (3S,5'S,6'S,8'R,11'S)-2'-ethenylspiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2-one |
|---|---|
| PubChem CID | 164610079 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (3S,5'S,6'S,8'R,11'S)-2'-ethenylspiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2-one |
| SMILES | C=CC12CN[C@@H]3[C@H]4CO[C@H](CC41)[C@]1(C(=O)Nc4ccccc41)[C@@H]32 |
| InChI | InChI=1S/C19H20N2O2/c1-2-18-9-20-15-10-8-23-14(7-12(10)18)19(16(15)18)11-5-3-4-6-13(11)21-17(19)22/h2-6,10,12,14-16,20H,1,7-9H2,(H,21,22)/t10-,12?,14+,15+,16-,18?,19-/m0/s1 |
| InChIKey | CTHVRFQZSMTZBX-NCBBZYJTSA-N |
| XLogP | 1.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|