C19H18N2O4 — CID 135014111
(1'R,3R,8'S)-4'-methyl-2,3'-dioxospiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2'-carbaldehyde (PubChem CID 135014111) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (1'R,3R,8'S)-4'-methyl-2,3'-dioxospiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2'-carbaldehyde.
| Compound Name | (1'R,3R,8'S)-4'-methyl-2,3'-dioxospiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2'-carbaldehyde |
|---|---|
| PubChem CID | 135014111 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (1'R,3R,8'S)-4'-methyl-2,3'-dioxospiro[1H-indole-3,7'-9-oxa-4-azatetracyclo[6.3.1.02,6.05,11]dodecane]-2'-carbaldehyde |
| SMILES | CN1C(=O)C2(C=O)C3C1C1CO[C@@H](C[C@H]12)[C@@]31C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C19H18N2O4/c1-21-14-9-7-25-13-6-11(9)18(8-22,17(21)24)15(14)19(13)10-4-2-3-5-12(10)20-16(19)23/h2-5,8-9,11,13-15H,6-7H2,1H3,(H,20,23)/t9?,11-,13+,14?,15?,18?,19-/m1/s1 |
| InChIKey | CZBXPPZKTQMZNC-IEPLBSMXSA-N |
| XLogP | 0.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|