C15H12N2O3 — CID 164610325
5,6-dihydroxy-N-phenyl-1H-indole-2-carboxamide (PubChem CID 164610325) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 5,6-dihydroxy-N-phenyl-1H-indole-2-carboxamide.
| Compound Name | 5,6-dihydroxy-N-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 164610325 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5,6-dihydroxy-N-phenyl-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc2cc(O)c(O)cc2[nH]1 |
| InChI | InChI=1S/C15H12N2O3/c18-13-7-9-6-12(17-11(9)8-14(13)19)15(20)16-10-4-2-1-3-5-10/h1-8,17-19H,(H,16,20) |
| InChIKey | BPDAZDDZVYEWCA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|