C16H12Cl2N2O — CID 164610439
8-(2,4-dichlorophenyl)-3,6-dimethylquinazolin-4-one (PubChem CID 164610439) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-3,6-dimethylquinazolin-4-one.
| Compound Name | 8-(2,4-dichlorophenyl)-3,6-dimethylquinazolin-4-one |
|---|---|
| PubChem CID | 164610439 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-3,6-dimethylquinazolin-4-one |
| SMILES | Cc1cc(-c2ccc(Cl)cc2Cl)c2ncn(C)c(=O)c2c1 |
| InChI | InChI=1S/C16H12Cl2N2O/c1-9-5-12(11-4-3-10(17)7-14(11)18)15-13(6-9)16(21)20(2)8-19-15/h3-8H,1-2H3 |
| InChIKey | RSKHPANXURRXHS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |