C21H17N5O3S — CID 164611501
3-[(E)-(6-benzyl-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-4-yl)iminomethyl]-6-methoxy-1H-quinolin-2-one (PubChem CID 164611501) has the molecular formula C21H17N5O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is 3-[(E)-(6-benzyl-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-4-yl)iminomethyl]-6-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[(E)-(6-benzyl-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-4-yl)iminomethyl]-6-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 164611501 |
| Molecular Formula | C21H17N5O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 3-[(E)-(6-benzyl-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-4-yl)iminomethyl]-6-methoxy-1H-quinolin-2-one |
| SMILES | COc1ccc2[nH]c(=O)c(/C=N/n3c(=S)[nH]nc(Cc4ccccc4)c3=O)cc2c1 |
| InChI | InChI=1S/C21H17N5O3S/c1-29-16-7-8-17-14(11-16)10-15(19(27)23-17)12-22-26-20(28)18(24-25-21(26)30)9-13-5-3-2-4-6-13/h2-8,10-12H,9H2,1H3,(H,23,27)(H,25,30)/b22-12+ |
| InChIKey | RUADLYXYPZRIQS-WSDLNYQXSA-N |
| XLogP | 2.62 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|