C24H29N3O4 — CID 164613299
4-[[[2-(cyclohexylamino)-2-oxoethyl]-(2-phenylacetyl)amino]methyl]-N-hydroxybenzamide (PubChem CID 164613299) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 4-[[[2-(cyclohexylamino)-2-oxoethyl]-(2-phenylacetyl)amino]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[[2-(cyclohexylamino)-2-oxoethyl]-(2-phenylacetyl)amino]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 164613299 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 4-[[[2-(cyclohexylamino)-2-oxoethyl]-(2-phenylacetyl)amino]methyl]-N-hydroxybenzamide |
| SMILES | O=C(CN(Cc1ccc(C(=O)NO)cc1)C(=O)Cc1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C24H29N3O4/c28-22(25-21-9-5-2-6-10-21)17-27(23(29)15-18-7-3-1-4-8-18)16-19-11-13-20(14-12-19)24(30)26-31/h1,3-4,7-8,11-14,21,31H,2,5-6,9-10,15-17H2,(H,25,28)(H,26,30) |
| InChIKey | IUWIVEROLJCNHO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|