C24H26N4O4 — CID 177380043
N-[2-(cyclopentylamino)-2-oxoethyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1H-indole-3-carboxamide (PubChem CID 177380043) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[2-(cyclopentylamino)-2-oxoethyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1H-indole-3-carboxamide.
| Compound Name | N-[2-(cyclopentylamino)-2-oxoethyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 177380043 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[2-(cyclopentylamino)-2-oxoethyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-1H-indole-3-carboxamide |
| SMILES | O=C(CN(Cc1ccc(C(=O)NO)cc1)C(=O)c1c[nH]c2ccccc12)NC1CCCC1 |
| InChI | InChI=1S/C24H26N4O4/c29-22(26-18-5-1-2-6-18)15-28(14-16-9-11-17(12-10-16)23(30)27-32)24(31)20-13-25-21-8-4-3-7-19(20)21/h3-4,7-13,18,25,32H,1-2,5-6,14-15H2,(H,26,29)(H,27,30) |
| InChIKey | KGUDHGLURVRSGE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|