C15H22N2O6S — CID 164613440
dipropan-2-yl 2-(4-sulfamoylanilino)propanedioate (PubChem CID 164613440) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is dipropan-2-yl 2-(4-sulfamoylanilino)propanedioate.
| Compound Name | dipropan-2-yl 2-(4-sulfamoylanilino)propanedioate |
|---|---|
| PubChem CID | 164613440 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | dipropan-2-yl 2-(4-sulfamoylanilino)propanedioate |
| SMILES | CC(C)OC(=O)C(Nc1ccc(S(N)(=O)=O)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C15H22N2O6S/c1-9(2)22-14(18)13(15(19)23-10(3)4)17-11-5-7-12(8-6-11)24(16,20)21/h5-10,13,17H,1-4H3,(H2,16,20,21) |
| InChIKey | BHSQJGIHRTYLNT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|