C25H22N2O6S — CID 164613784
5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-[[4-(thiophene-2-carbonyl)piperazin-1-yl]methyl]chromen-4-one (PubChem CID 164613784) has the molecular formula C25H22N2O6S and a molecular weight of 478.50 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[[4-(thiophene-2-carbonyl)piperazin-1-yl]methyl]chromen-4-one.
| Compound Name | 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-[[4-(thiophene-2-carbonyl)piperazin-1-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 164613784 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[[4-(thiophene-2-carbonyl)piperazin-1-yl]methyl]chromen-4-one |
| SMILES | C1CN(CCN1CC2=C3C(=C(C=C2O)O)C(=O)C=C(O3)C4=CC=C(C=C4)O)C(=O)C5=CC=CS5 |
| InChI | InChI=1S/C25H22N2O6S/c28-16-5-3-15(4-6-16)21-13-20(31)23-19(30)12-18(29)17(24(23)33-21)14-26-7-9-27(10-8-26)25(32)22-2-1-11-34-22/h1-6,11-13,28-30H,7-10,14H2 |
| InChIKey | OGVWIQISFGVSEU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | 792 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|