C24H28N2O5S — CID 5770968
(E)-N-[2-(cyclohexylamino)-2-oxoethyl]-4-(2-hydroxy-4-methoxyphenyl)-4-oxo-N-(thiophen-2-ylmethyl)but-2-enamide (PubChem CID 5770968) has the molecular formula C24H28N2O5S and a molecular weight of 456.60 g/mol. Its IUPAC name is (E)-N-[2-(cyclohexylamino)-2-oxoethyl]-4-(2-hydroxy-4-methoxyphenyl)-4-oxo-N-(thiophen-2-ylmethyl)but-2-enamide.
| Compound Name | (E)-N-[2-(cyclohexylamino)-2-oxoethyl]-4-(2-hydroxy-4-methoxyphenyl)-4-oxo-N-(thiophen-2-ylmethyl)but-2-enamide |
|---|---|
| PubChem CID | 5770968 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (E)-N-[2-(cyclohexylamino)-2-oxoethyl]-4-(2-hydroxy-4-methoxyphenyl)-4-oxo-N-(thiophen-2-ylmethyl)but-2-enamide |
| SMILES | COC1=CC(=C(C=C1)C(=O)/C=C/C(=O)N(CC2=CC=CS2)CC(=O)NC3CCCCC3)O |
| InChI | InChI=1S/C24H28N2O5S/c1-31-18-9-10-20(22(28)14-18)21(27)11-12-24(30)26(15-19-8-5-13-32-19)16-23(29)25-17-6-3-2-4-7-17/h5,8-14,17,28H,2-4,6-7,15-16H2,1H3,(H,25,29)/b12-11+ |
| InChIKey | GMGQPJXAWKHBEW-VAWYXSNFSA-N |
| XLogP | 3.80 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | 679 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|