C15H19N3O4 — CID 164613965
(3S,3aS)-3-(aminomethyl)-7-morpholin-4-yl-3a,9-dihydro-3H-[1,3]oxazolo[4,3-b][1,3]benzoxazin-1-one (PubChem CID 164613965) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is (3S,3aS)-3-(aminomethyl)-7-morpholin-4-yl-3a,9-dihydro-3H-[1,3]oxazolo[4,3-b][1,3]benzoxazin-1-one.
| Compound Name | (3S,3aS)-3-(aminomethyl)-7-morpholin-4-yl-3a,9-dihydro-3H-[1,3]oxazolo[4,3-b][1,3]benzoxazin-1-one |
|---|---|
| PubChem CID | 164613965 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (3S,3aS)-3-(aminomethyl)-7-morpholin-4-yl-3a,9-dihydro-3H-[1,3]oxazolo[4,3-b][1,3]benzoxazin-1-one |
| SMILES | NC[C@@H]1OC(=O)N2Cc3cc(N4CCOCC4)ccc3O[C@@H]12 |
| InChI | InChI=1S/C15H19N3O4/c16-8-13-14-18(15(19)22-13)9-10-7-11(1-2-12(10)21-14)17-3-5-20-6-4-17/h1-2,7,13-14H,3-6,8-9,16H2/t13-,14-/m0/s1 |
| InChIKey | NLTASZKROQXZRD-KBPBESRZSA-N |
| XLogP | 0.52 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|