C14H14N2O4 — CID 67759753
7-morpholin-4-yl-4-oxo-3H-quinoline-3-carboxylic acid (PubChem CID 67759753) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 7-morpholin-4-yl-4-oxo-3H-quinoline-3-carboxylic acid.
| Compound Name | 7-morpholin-4-yl-4-oxo-3H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67759753 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 7-morpholin-4-yl-4-oxo-3H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)C1C=Nc2cc(N3CCOCC3)ccc2C1=O |
| InChI | InChI=1S/C14H14N2O4/c17-13-10-2-1-9(16-3-5-20-6-4-16)7-12(10)15-8-11(13)14(18)19/h1-2,7-8,11H,3-6H2,(H,18,19) |
| InChIKey | VGCDBVUNQNEGMQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|