C19H27N3O2 — CID 9489775
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-morpholin-4-yl-2-pyridinyl)methanone (PubChem CID 9489775) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-morpholin-4-yl-2-pyridinyl)methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-morpholin-4-yl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 9489775 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(4-morpholin-4-yl-2-pyridinyl)methanone |
| SMILES | O=C(c1cc(N2CCOCC2)ccn1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C19H27N3O2/c23-19(22-8-6-15-3-1-2-4-16(15)14-22)18-13-17(5-7-20-18)21-9-11-24-12-10-21/h5,7,13,15-16H,1-4,6,8-12,14H2/t15-,16-/m0/s1 |
| InChIKey | QCZYPWLKNXBREM-HOTGVXAUSA-N |
| XLogP | 2.57 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |