C22H27N3O3 — CID 136534504
(4-morpholin-4-yl-2-pyridinyl)-[4-(phenoxymethyl)piperidin-1-yl]methanone (PubChem CID 136534504) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (4-morpholin-4-yl-2-pyridinyl)-[4-(phenoxymethyl)piperidin-1-yl]methanone.
| Compound Name | (4-morpholin-4-yl-2-pyridinyl)-[4-(phenoxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136534504 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (4-morpholin-4-yl-2-pyridinyl)-[4-(phenoxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(N2CCOCC2)ccn1)N1CCC(COc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N3O3/c26-22(21-16-19(6-9-23-21)24-12-14-27-15-13-24)25-10-7-18(8-11-25)17-28-20-4-2-1-3-5-20/h1-6,9,16,18H,7-8,10-15,17H2 |
| InChIKey | ILBQNMUWNRZOIG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |