C25H30N2O5 — CID 53150450
1-[4-[[4-(morpholine-4-carbonyl)phenoxy]methyl]piperidin-1-yl]-2-phenoxyethanone (PubChem CID 53150450) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is 1-[4-[[4-(morpholine-4-carbonyl)phenoxy]methyl]piperidin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-[[4-(morpholine-4-carbonyl)phenoxy]methyl]piperidin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 53150450 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-[4-[[4-(morpholine-4-carbonyl)phenoxy]methyl]piperidin-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCC(COc2ccc(C(=O)N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C25H30N2O5/c28-24(19-32-22-4-2-1-3-5-22)26-12-10-20(11-13-26)18-31-23-8-6-21(7-9-23)25(29)27-14-16-30-17-15-27/h1-9,20H,10-19H2 |
| InChIKey | CYOGBZOUOXGMJD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |