C25H29FN2O4 — CID 53150447
[4-[[1-(3-fluoro-4-methylbenzoyl)piperidin-4-yl]methoxy]phenyl]-morpholin-4-ylmethanone (PubChem CID 53150447) has the molecular formula C25H29FN2O4 and a molecular weight of 440.52 g/mol. Its IUPAC name is [4-[[1-(3-fluoro-4-methylbenzoyl)piperidin-4-yl]methoxy]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[[1-(3-fluoro-4-methylbenzoyl)piperidin-4-yl]methoxy]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 53150447 |
| Molecular Formula | C25H29FN2O4 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [4-[[1-(3-fluoro-4-methylbenzoyl)piperidin-4-yl]methoxy]phenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1ccc(C(=O)N2CCC(COc3ccc(C(=O)N4CCOCC4)cc3)CC2)cc1F |
| InChI | InChI=1S/C25H29FN2O4/c1-18-2-3-21(16-23(18)26)25(30)27-10-8-19(9-11-27)17-32-22-6-4-20(5-7-22)24(29)28-12-14-31-15-13-28/h2-7,16,19H,8-15,17H2,1H3 |
| InChIKey | MYQZXUSNYWOBNP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |