C23H27N3O4 — CID 53150425
morpholin-4-yl-[4-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methoxy]phenyl]methanone (PubChem CID 53150425) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is morpholin-4-yl-[4-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methoxy]phenyl]methanone.
| Compound Name | morpholin-4-yl-[4-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 53150425 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | morpholin-4-yl-[4-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(OCC2CCN(C(=O)c3ccncc3)CC2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C23H27N3O4/c27-22(26-13-15-29-16-14-26)19-1-3-21(4-2-19)30-17-18-7-11-25(12-8-18)23(28)20-5-9-24-10-6-20/h1-6,9-10,18H,7-8,11-17H2 |
| InChIKey | QKNWMLGYOBRTEU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |